C10H22ClN2+ — CID 21254476
4-(2-chloroethyl)-1,1-diethylpiperazin-1-ium (PubChem CID 21254476) has the molecular formula C10H22ClN2+ and a molecular weight of 205.75 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1,1-diethylpiperazin-1-ium.
| Compound Name | 4-(2-chloroethyl)-1,1-diethylpiperazin-1-ium |
|---|---|
| PubChem CID | 21254476 |
| Molecular Formula | C10H22ClN2+ |
| Molecular Weight | 205.75 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-(2-chloroethyl)-1,1-diethylpiperazin-1-ium |
| SMILES | CC[N+]1(CC)CCN(CCCl)CC1 |
| InChI | InChI=1S/C10H22ClN2/c1-3-13(4-2)9-7-12(6-5-11)8-10-13/h3-10H2,1-2H3/q+1 |
| InChIKey | PFWMLVBZDVWPKC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.75 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|