C12H27N3O+2 — CID 170732630
2-(3,3-dimethyl-9-aza-3,6-diazoniaspiro[5.5]undecan-9-yl)ethanol (PubChem CID 170732630) has the molecular formula C12H27N3O+2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-(3,3-dimethyl-9-aza-3,6-diazoniaspiro[5.5]undecan-9-yl)ethanol.
| Compound Name | 2-(3,3-dimethyl-9-aza-3,6-diazoniaspiro[5.5]undecan-9-yl)ethanol |
|---|---|
| PubChem CID | 170732630 |
| Molecular Formula | C12H27N3O+2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.21 |
| IUPAC Name | 2-(3,3-dimethyl-9-aza-3,6-diazoniaspiro[5.5]undecan-9-yl)ethanol |
| SMILES | C[N+]1(C)CC[N+]2(CCN(CCO)CC2)CC1 |
| InChI | InChI=1S/C12H27N3O/c1-14(2)8-10-15(11-9-14)6-3-13(4-7-15)5-12-16/h16H,3-12H2,1-2H3/q+2 |
| InChIKey | GQXFSOUJORFLER-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|