C16H18ClN5O3 — CID 139744431
2-[[1-[1-(4-chlorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)ethyl]cyclopropyl]methylideneamino]oxyacetamide (PubChem CID 139744431) has the molecular formula C16H18ClN5O3 and a molecular weight of 363.81 g/mol. Its IUPAC name is 2-[[1-[1-(4-chlorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)ethyl]cyclopropyl]methylideneamino]oxyacetamide.
| Compound Name | 2-[[1-[1-(4-chlorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)ethyl]cyclopropyl]methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 139744431 |
| Molecular Formula | C16H18ClN5O3 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[[1-[1-(4-chlorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)ethyl]cyclopropyl]methylideneamino]oxyacetamide |
| SMILES | NC(=O)CON=CC1(C(O)(Cn2cncn2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H18ClN5O3/c17-13-3-1-12(2-4-13)16(24,9-22-11-19-10-20-22)15(5-6-15)8-21-25-7-14(18)23/h1-4,8,10-11,24H,5-7,9H2,(H2,18,23) |
| InChIKey | JGCHZSMBHOUOEF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|