About 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol
1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 76899928) has the molecular formula C18H17ClN4O
and a molecular weight of 340.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol |
| PubChem CID | 76899928 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | OC(Cn1cncn1)(c1ccc(Cl)cc1)C1(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H17ClN4O/c19-15-6-4-14(5-7-15)18(24,11-23-13-20-12-22-23)17(8-9-17)16-3-1-2-10-21-16/h1-7,10,12-13,24H,8-9,11H2 |
| InChIKey | GUSBHEMDCLIZNH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol?
The IUPAC name of 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol (CID 76899928) is 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol.
What is the SMILES notation for 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol?
The canonical SMILES for 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol is OC(Cn1cncn1)(c1ccc(Cl)cc1)C1(c2ccccn2)CC1.
What is the InChIKey of 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol?
The InChIKey is GUSBHEMDCLIZNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN4O/c19-15-6-4-14(5-7-15)18(24,11-23-13-20-12-22-23)17(8-9-17)16-3-1-2-10-21-16/h1-7,10,12-13,24H,8-9,11H2.
What are the key properties of 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol?
1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol has a molecular weight of 340.81 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-1-(1-pyridin-2-ylcyclopropyl)-2-(1,2,4-triazol-1-yl)ethanol is sourced from PubChem (CID 76899928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).