C19H28N2S — CID 139744682
N-[2-(2,6-dimethylphenyl)heptyl]-5-methyl-1,3-thiazol-2-amine (PubChem CID 139744682) has the molecular formula C19H28N2S and a molecular weight of 316.51 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenyl)heptyl]-5-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[2-(2,6-dimethylphenyl)heptyl]-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 139744682 |
| Molecular Formula | C19H28N2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-[2-(2,6-dimethylphenyl)heptyl]-5-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCCC(CNc1ncc(C)s1)c1c(C)cccc1C |
| InChI | InChI=1S/C19H28N2S/c1-5-6-7-11-17(13-21-19-20-12-16(4)22-19)18-14(2)9-8-10-15(18)3/h8-10,12,17H,5-7,11,13H2,1-4H3,(H,20,21) |
| InChIKey | CGDMXDPIYKNLKT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|