C10H10NOS+ — CID 139746149
4-(1,3-thiazol-3-ium-3-ylmethyl)phenol (PubChem CID 139746149) has the molecular formula C10H10NOS+ and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(1,3-thiazol-3-ium-3-ylmethyl)phenol.
| Compound Name | 4-(1,3-thiazol-3-ium-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 139746149 |
| Molecular Formula | C10H10NOS+ |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-(1,3-thiazol-3-ium-3-ylmethyl)phenol |
| SMILES | Oc1ccc(C[n+]2ccsc2)cc1 |
| InChI | InChI=1S/C10H9NOS/c12-10-3-1-9(2-4-10)7-11-5-6-13-8-11/h1-6,8H,7H2/p+1 |
| InChIKey | RLOYEUDUUJPSQN-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|