About methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride
methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride (PubChem CID 139746617) has the molecular formula C23H29Cl2NO2
and a molecular weight of 422.40 g/mol. Its IUPAC name is methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride |
| PubChem CID | 139746617 |
| Molecular Formula | C23H29Cl2NO2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)C1(Cc2ccc(Cl)cc2)CCCN(CCCc2ccccc2)C1.Cl |
| InChI | InChI=1S/C23H28ClNO2.ClH/c1-27-22(26)23(17-20-10-12-21(24)13-11-20)14-6-16-25(18-23)15-5-9-19-7-3-2-4-8-19;/h2-4,7-8,10-13H,5-6,9,14-18H2,1H3;1H |
| InChIKey | SREYSBVFKYMXKC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride?
The IUPAC name of methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride (CID 139746617) is methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride.
What is the SMILES notation for methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride?
The canonical SMILES for methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride is COC(=O)C1(Cc2ccc(Cl)cc2)CCCN(CCCc2ccccc2)C1.Cl.
What is the InChIKey of methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride?
The InChIKey is SREYSBVFKYMXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClNO2.ClH/c1-27-22(26)23(17-20-10-12-21(24)13-11-20)14-6-16-25(18-23)15-5-9-19-7-3-2-4-8-19;/h2-4,7-8,10-13H,5-6,9,14-18H2,1H3;1H.
What are the key properties of methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride?
methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride has a molecular weight of 422.40 g/mol, XLogP of 5.19, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4-chlorophenyl)methyl]-1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride is sourced from PubChem (CID 139746617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).