C16H20O8 — CID 139747260
tetramethyl 1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate (PubChem CID 139747260) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is tetramethyl 1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate.
| Compound Name | tetramethyl 1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate |
|---|---|
| PubChem CID | 139747260 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | tetramethyl 1,2,3,6-tetrahydropentalene-1,3a,4,6a-tetracarboxylate |
| SMILES | COC(=O)C1=CCC2(C(=O)OC)C(C(=O)OC)CCC12C(=O)OC |
| InChI | InChI=1S/C16H20O8/c1-21-11(17)9-5-7-16(14(20)24-4)10(12(18)22-2)6-8-15(9,16)13(19)23-3/h5,10H,6-8H2,1-4H3 |
| InChIKey | ILBCXFOQPHUBHZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|