C31H22ClF6OPS2 — CID 139748093
[(4-chlorophenyl)-[4-[4-(4-phenylsulfanylphenyl)phenyl]sulfanylphenyl]methylidene]oxidanium hexafluorophosphate (PubChem CID 139748093) has the molecular formula C31H22ClF6OPS2 and a molecular weight of 655.07 g/mol. Its IUPAC name is [(4-chlorophenyl)-[4-[4-(4-phenylsulfanylphenyl)phenyl]sulfanylphenyl]methylidene]oxidanium hexafluorophosphate.
| Compound Name | [(4-chlorophenyl)-[4-[4-(4-phenylsulfanylphenyl)phenyl]sulfanylphenyl]methylidene]oxidanium hexafluorophosphate |
|---|---|
| PubChem CID | 139748093 |
| Molecular Formula | C31H22ClF6OPS2 |
| Molecular Weight | 655.07 g/mol |
| Exact Mass | 654.04 |
| IUPAC Name | [(4-chlorophenyl)-[4-[4-(4-phenylsulfanylphenyl)phenyl]sulfanylphenyl]methylidene]oxidanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[H]/[O+]=C(\c1ccc(Cl)cc1)c1ccc(Sc2ccc(-c3ccc(Sc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H21ClOS2.F6P/c32-26-14-6-24(7-15-26)31(33)25-12-20-30(21-13-25)35-29-18-10-23(11-19-29)22-8-16-28(17-9-22)34-27-4-2-1-3-5-27;1-7(2,3,4,5)6/h1-21H;/q;-1/p+1 |
| InChIKey | GRWZHXCTSURRSG-UHFFFAOYSA-O |
| XLogP | 12.63 |
| TPSA | 21.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.07 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|