C31H20BCl3F4OS2 — CID 142710056
[[3-chloro-4-[4-[5-chloro-2-(4-chlorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium tetrafluoroborate (PubChem CID 142710056) has the molecular formula C31H20BCl3F4OS2 and a molecular weight of 665.80 g/mol. Its IUPAC name is [[3-chloro-4-[4-[5-chloro-2-(4-chlorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium tetrafluoroborate.
| Compound Name | [[3-chloro-4-[4-[5-chloro-2-(4-chlorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium tetrafluoroborate |
|---|---|
| PubChem CID | 142710056 |
| Molecular Formula | C31H20BCl3F4OS2 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 664.01 |
| IUPAC Name | [[3-chloro-4-[4-[5-chloro-2-(4-chlorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.[H]/[O+]=C(\c1ccccc1)c1ccc(Sc2ccc(-c3cc(Cl)ccc3Sc3ccc(Cl)cc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C31H19Cl3OS2.BF4/c32-23-9-14-26(15-10-23)36-29-17-11-24(33)19-27(29)20-6-12-25(13-7-20)37-30-16-8-22(18-28(30)34)31(35)21-4-2-1-3-5-21;2-1(3,4)5/h1-19H;/q;-1/p+1 |
| InChIKey | YJGLYAKDNNVOAU-UHFFFAOYSA-O |
| XLogP | 11.86 |
| TPSA | 21.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|