C21H40N2O5S — CID 139749849
[2-[2-[2-(hydroxyamino)-2-oxoethyl]undecanoylamino]-3-methyl-3-methylsulfanylbutyl] acetate (PubChem CID 139749849) has the molecular formula C21H40N2O5S and a molecular weight of 432.63 g/mol. Its IUPAC name is [2-[2-[2-(hydroxyamino)-2-oxoethyl]undecanoylamino]-3-methyl-3-methylsulfanylbutyl] acetate.
| Compound Name | [2-[2-[2-(hydroxyamino)-2-oxoethyl]undecanoylamino]-3-methyl-3-methylsulfanylbutyl] acetate |
|---|---|
| PubChem CID | 139749849 |
| Molecular Formula | C21H40N2O5S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | [2-[2-[2-(hydroxyamino)-2-oxoethyl]undecanoylamino]-3-methyl-3-methylsulfanylbutyl] acetate |
| SMILES | CCCCCCCCCC(CC(=O)NO)C(=O)NC(COC(C)=O)C(C)(C)SC |
| InChI | InChI=1S/C21H40N2O5S/c1-6-7-8-9-10-11-12-13-17(14-19(25)23-27)20(26)22-18(15-28-16(2)24)21(3,4)29-5/h17-18,27H,6-15H2,1-5H3,(H,22,26)(H,23,25) |
| InChIKey | AHPZSOJWAAZEQM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|