C13H17N3O2 — CID 139760804
5-(cyclohexylmethyl)-7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium (PubChem CID 139760804) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium.
| Compound Name | 5-(cyclohexylmethyl)-7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium |
|---|---|
| PubChem CID | 139760804 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-(cyclohexylmethyl)-7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium |
| SMILES | Cc1cc(CC2CCCCC2)nc2no[n+]([O-])c12 |
| InChI | InChI=1S/C13H17N3O2/c1-9-7-11(8-10-5-3-2-4-6-10)14-13-12(9)16(17)18-15-13/h7,10H,2-6,8H2,1H3 |
| InChIKey | WJLUAXGBUDDVGB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|