C34H32N2O3 — CID 139761199
1'-[(1-anilino-2,4-dimethylcyclohexyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139761199) has the molecular formula C34H32N2O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is 1'-[(1-anilino-2,4-dimethylcyclohexyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 1'-[(1-anilino-2,4-dimethylcyclohexyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139761199 |
| Molecular Formula | C34H32N2O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 1'-[(1-anilino-2,4-dimethylcyclohexyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC1CCC(Nc2ccccc2)(Nc2cccc3c2C2(OC(=O)c4ccccc42)c2ccccc2O3)C(C)C1 |
| InChI | InChI=1S/C34H32N2O3/c1-22-19-20-33(23(2)21-22,35-24-11-4-3-5-12-24)36-28-16-10-18-30-31(28)34(27-15-8-9-17-29(27)38-30)26-14-7-6-13-25(26)32(37)39-34/h3-18,22-23,35-36H,19-21H2,1-2H3 |
| InChIKey | MDQGEIUHFDTCHZ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|