C32H33NO6 — CID 139620192
tert-butyl 1-[[(3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)amino]methyl]cyclohexane-1-carboperoxoate (PubChem CID 139620192) has the molecular formula C32H33NO6 and a molecular weight of 527.62 g/mol. Its IUPAC name is tert-butyl 1-[[(3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)amino]methyl]cyclohexane-1-carboperoxoate.
| Compound Name | tert-butyl 1-[[(3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)amino]methyl]cyclohexane-1-carboperoxoate |
|---|---|
| PubChem CID | 139620192 |
| Molecular Formula | C32H33NO6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | tert-butyl 1-[[(3-oxospiro[2-benzofuran-1,9'-xanthene]-1'-yl)amino]methyl]cyclohexane-1-carboperoxoate |
| SMILES | CC(C)(C)OOC(=O)C1(CNc2cccc3c2C2(OC(=O)c4ccccc42)c2ccccc2O3)CCCCC1 |
| InChI | InChI=1S/C32H33NO6/c1-30(2,3)39-38-29(35)31(18-9-4-10-19-31)20-33-24-15-11-17-26-27(24)32(23-14-7-8-16-25(23)36-26)22-13-6-5-12-21(22)28(34)37-32/h5-8,11-17,33H,4,9-10,18-20H2,1-3H3 |
| InChIKey | QIXXWDJJNDIKEG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|