C11H11Cl3O3S — CID 139761262
(4R)-1-(benzenesulfinyl)-5,5,5-trichloro-4-hydroxypentan-2-one (PubChem CID 139761262) has the molecular formula C11H11Cl3O3S and a molecular weight of 329.63 g/mol. Its IUPAC name is (4R)-1-(benzenesulfinyl)-5,5,5-trichloro-4-hydroxypentan-2-one.
| Compound Name | (4R)-1-(benzenesulfinyl)-5,5,5-trichloro-4-hydroxypentan-2-one |
|---|---|
| PubChem CID | 139761262 |
| Molecular Formula | C11H11Cl3O3S |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | (4R)-1-(benzenesulfinyl)-5,5,5-trichloro-4-hydroxypentan-2-one |
| SMILES | O=C(C[C@@H](O)C(Cl)(Cl)Cl)CS(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11Cl3O3S/c12-11(13,14)10(16)6-8(15)7-18(17)9-4-2-1-3-5-9/h1-5,10,16H,6-7H2/t10-,18?/m1/s1 |
| InChIKey | JDHQGFLQSBUMRQ-DMPGVRBJSA-N |
| XLogP | 2.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|