C19H24O7 — CID 139761349
(Z)-4-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-3-methylbutoxy]-4-oxobut-2-enoic acid (PubChem CID 139761349) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (Z)-4-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-3-methylbutoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-3-methylbutoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 139761349 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (Z)-4-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]-3-methylbutoxy]-4-oxobut-2-enoic acid |
| SMILES | CC(C)C(COC(=O)/C=C\C(=O)O)Oc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C19H24O7/c1-12(2)15(11-25-17(22)10-9-16(20)21)26-14-7-5-13(6-8-14)18(23)19(3,4)24/h5-10,12,15,24H,11H2,1-4H3,(H,20,21)/b10-9- |
| InChIKey | UBEQUZRIGFBKMN-KTKRTIGZSA-N |
| XLogP | 2.23 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|