C35H37N3O6 — CID 139770079
N-[3-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide (PubChem CID 139770079) has the molecular formula C35H37N3O6 and a molecular weight of 595.70 g/mol. Its IUPAC name is N-[3-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide.
| Compound Name | N-[3-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide |
|---|---|
| PubChem CID | 139770079 |
| Molecular Formula | C35H37N3O6 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | N-[3-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide |
| SMILES | COc1ccc(CN(C)CCCOc2cccc(NC(=O)Cc3cccc4c(=O)c5cccc(OC)c5[nH]c34)c2)cc1OC |
| InChI | InChI=1S/C35H37N3O6/c1-38(22-23-15-16-29(41-2)31(19-23)43-4)17-8-18-44-26-11-6-10-25(21-26)36-32(39)20-24-9-5-12-27-33(24)37-34-28(35(27)40)13-7-14-30(34)42-3/h5-7,9-16,19,21H,8,17-18,20,22H2,1-4H3,(H,36,39)(H,37,40) |
| InChIKey | YTRKQAVFFHQGDD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|