C34H42N4O5S — CID 139771788
(4R)-N-[(3-amino-2-methylphenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 139771788) has the molecular formula C34H42N4O5S and a molecular weight of 618.80 g/mol. Its IUPAC name is (4R)-N-[(3-amino-2-methylphenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-[(3-amino-2-methylphenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 139771788 |
| Molecular Formula | C34H42N4O5S |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | (4R)-N-[(3-amino-2-methylphenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@H](O)C(=O)N1CSC(C)(C)[C@H]1C(=O)NCc1cccc(N)c1C |
| InChI | InChI=1S/C34H42N4O5S/c1-21-11-9-12-22(2)30(21)43-19-28(39)37-27(17-24-13-7-6-8-14-24)29(40)33(42)38-20-44-34(4,5)31(38)32(41)36-18-25-15-10-16-26(35)23(25)3/h6-16,27,29,31,40H,17-20,35H2,1-5H3,(H,36,41)(H,37,39)/t27-,29-,31+/m0/s1 |
| InChIKey | REELGHIXVZWAEP-DEDOGFMKSA-N |
| XLogP | 3.66 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|