C34H43N3O5S — CID 89172142
(4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 89172142) has the molecular formula C34H43N3O5S and a molecular weight of 605.80 g/mol. Its IUPAC name is (4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 89172142 |
| Molecular Formula | C34H43N3O5S |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | (4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-[(2E,4Z)-5-methylhepta-2,4,6-trienyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | C=C/C(C)=C\C=C\CNC(=O)[C@H]1N(C(=O)[C@@H](O)[C@H](Cc2ccccc2)NC(=O)COc2c(C)cccc2C)CSC1(C)C |
| InChI | InChI=1S/C34H43N3O5S/c1-7-23(2)14-11-12-19-35-32(40)31-34(5,6)43-22-37(31)33(41)29(39)27(20-26-17-9-8-10-18-26)36-28(38)21-42-30-24(3)15-13-16-25(30)4/h7-18,27,29,31,39H,1,19-22H2,2-6H3,(H,35,40)(H,36,38)/b12-11+,23-14-/t27-,29-,31+/m0/s1 |
| InChIKey | NBXAKBFQDAADIN-LCNONXHNSA-N |
| XLogP | 4.26 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|