C36H39N3O5S — CID 70995447
(4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-naphthalen-1-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 70995447) has the molecular formula C36H39N3O5S and a molecular weight of 625.79 g/mol. Its IUPAC name is (4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-naphthalen-1-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-naphthalen-1-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 70995447 |
| Molecular Formula | C36H39N3O5S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | (4R)-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-N-naphthalen-1-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@H](O)C(=O)N1CSC(C)(C)[C@H]1C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C36H39N3O5S/c1-23-12-10-13-24(2)32(23)44-21-30(40)37-29(20-25-14-6-5-7-15-25)31(41)35(43)39-22-45-36(3,4)33(39)34(42)38-28-19-11-17-26-16-8-9-18-27(26)28/h5-19,29,31,33,41H,20-22H2,1-4H3,(H,37,40)(H,38,42)/t29-,31-,33+/m0/s1 |
| InChIKey | YWMUKSSSLVHDLF-FXFVSWTPSA-N |
| XLogP | 5.24 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |