C33H38ClN3O5S — CID 58805301
N-[(2-chlorophenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 58805301) has the molecular formula C33H38ClN3O5S and a molecular weight of 624.20 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 58805301 |
| Molecular Formula | C33H38ClN3O5S |
| Molecular Weight | 624.20 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-[(2S,3S)-3-[[2-(2,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@H](O)C(=O)N1CSC(C)(C)C1C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C33H38ClN3O5S/c1-21-11-10-12-22(2)29(21)42-19-27(38)36-26(17-23-13-6-5-7-14-23)28(39)32(41)37-20-43-33(3,4)30(37)31(40)35-18-24-15-8-9-16-25(24)34/h5-16,26,28,30,39H,17-20H2,1-4H3,(H,35,40)(H,36,38)/t26-,28-,30?/m0/s1 |
| InChIKey | CZWBPMHERUVEGK-HSEOLAPHSA-N |
| XLogP | 4.42 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |