C26H31Cl2N3O5S — CID 58805394
(4R)-3-[(2S,3S)-3-[[2-(2,6-dichlorophenoxy)acetyl]amino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 58805394) has the molecular formula C26H31Cl2N3O5S and a molecular weight of 568.52 g/mol. Its IUPAC name is (4R)-3-[(2S,3S)-3-[[2-(2,6-dichlorophenoxy)acetyl]amino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-[(2S,3S)-3-[[2-(2,6-dichlorophenoxy)acetyl]amino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 58805394 |
| Molecular Formula | C26H31Cl2N3O5S |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | (4R)-3-[(2S,3S)-3-[[2-(2,6-dichlorophenoxy)acetyl]amino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)[C@H]1N(C(=O)[C@@H](O)[C@H](C)NC(=O)COc2c(Cl)cccc2Cl)CSC1(C)C |
| InChI | InChI=1S/C26H31Cl2N3O5S/c1-15-8-5-6-9-17(15)12-29-24(34)23-26(3,4)37-14-31(23)25(35)21(33)16(2)30-20(32)13-36-22-18(27)10-7-11-19(22)28/h5-11,16,21,23,33H,12-14H2,1-4H3,(H,29,34)(H,30,32)/t16-,21-,23+/m0/s1 |
| InChIKey | YHNDNWHXWVNGGL-JFJYTDJESA-N |
| XLogP | 3.54 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |