C17H21Cl2N3O2 — CID 139773469
5,7-dichloro-1-(4-piperidin-1-ylbutyl)quinazoline-2,4-dione (PubChem CID 139773469) has the molecular formula C17H21Cl2N3O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 5,7-dichloro-1-(4-piperidin-1-ylbutyl)quinazoline-2,4-dione.
| Compound Name | 5,7-dichloro-1-(4-piperidin-1-ylbutyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 139773469 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5,7-dichloro-1-(4-piperidin-1-ylbutyl)quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCCCN2CCCCC2)c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C17H21Cl2N3O2/c18-12-10-13(19)15-14(11-12)22(17(24)20-16(15)23)9-5-4-8-21-6-2-1-3-7-21/h10-11H,1-9H2,(H,20,23,24) |
| InChIKey | JKIDXLSWCONWKY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|