C17H13Cl2N3O3 — CID 139805061
N-benzyl-2-(5,7-dichloro-2,4-dioxoquinazolin-1-yl)acetamide (PubChem CID 139805061) has the molecular formula C17H13Cl2N3O3 and a molecular weight of 378.22 g/mol. Its IUPAC name is N-benzyl-2-(5,7-dichloro-2,4-dioxoquinazolin-1-yl)acetamide.
| Compound Name | N-benzyl-2-(5,7-dichloro-2,4-dioxoquinazolin-1-yl)acetamide |
|---|---|
| PubChem CID | 139805061 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-benzyl-2-(5,7-dichloro-2,4-dioxoquinazolin-1-yl)acetamide |
| SMILES | O=C(Cn1c(=O)[nH]c(=O)c2c(Cl)cc(Cl)cc21)NCc1ccccc1 |
| InChI | InChI=1S/C17H13Cl2N3O3/c18-11-6-12(19)15-13(7-11)22(17(25)21-16(15)24)9-14(23)20-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,20,23)(H,21,24,25) |
| InChIKey | HEDGVTBOOLJPMY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |