C16H24O4S — CID 139777358
2-[(3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxolane (PubChem CID 139777358) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-[(3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxolane.
| Compound Name | 2-[(3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxolane |
|---|---|
| PubChem CID | 139777358 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[(3R)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxolane |
| SMILES | C[C@@H](CS(=O)(=O)c1ccccc1)C(C)(C)OC1CCCO1 |
| InChI | InChI=1S/C16H24O4S/c1-13(16(2,3)20-15-10-7-11-19-15)12-21(17,18)14-8-5-4-6-9-14/h4-6,8-9,13,15H,7,10-12H2,1-3H3/t13-,15?/m0/s1 |
| InChIKey | FTUFMMOSDCGZFH-CFMCSPIPSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |