C44H41F3O8S2 — CID 139785778
[bis[4-(oxan-2-yloxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139785778) has the molecular formula C44H41F3O8S2 and a molecular weight of 818.93 g/mol. Its IUPAC name is [bis[4-(oxan-2-yloxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [bis[4-(oxan-2-yloxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139785778 |
| Molecular Formula | C44H41F3O8S2 |
| Molecular Weight | 818.93 g/mol |
| Exact Mass | 818.22 |
| IUPAC Name | [bis[4-(oxan-2-yloxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccc(OCc2cc3ccccc3c3ccccc23)cc1)(c1ccc(OC2CCCCO2)cc1)c1ccc(OC2CCCCO2)cc1)C(F)(F)F |
| InChI | InChI=1S/C44H41F3O8S2/c45-44(46,47)57(48,49)55-56(37-23-17-34(18-24-37)53-42-13-5-7-27-50-42,38-25-19-35(20-26-38)54-43-14-6-8-28-51-43)36-21-15-33(16-22-36)52-30-32-29-31-9-1-2-10-39(31)41-12-4-3-11-40(32)41/h1-4,9-12,15-26,29,42-43H,5-8,13-14,27-28,30H2 |
| InChIKey | ZRQQYTOPFHOFJB-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.93 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|