C15H11F6N3O5S — CID 139787100
(2,2,2-trifluoroacetyl) (6R,7R)-7-amino-8-oxo-3-[(Z)-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-ylidene]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139787100) has the molecular formula C15H11F6N3O5S and a molecular weight of 459.32 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (6R,7R)-7-amino-8-oxo-3-[(Z)-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-ylidene]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (6R,7R)-7-amino-8-oxo-3-[(Z)-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-ylidene]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139787100 |
| Molecular Formula | C15H11F6N3O5S |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (6R,7R)-7-amino-8-oxo-3-[(Z)-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-ylidene]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)OC(=O)C(F)(F)F)=C(/C=C3/CN(CC(F)(F)F)C3=O)CS[C@H]12 |
| InChI | InChI=1S/C15H11F6N3O5S/c16-14(17,18)4-23-2-5(9(23)25)1-6-3-30-11-7(22)10(26)24(11)8(6)12(27)29-13(28)15(19,20)21/h1,7,11H,2-4,22H2/b5-1-/t7-,11-/m1/s1 |
| InChIKey | IKEXKMUYIINPHS-QOIIJFRXSA-N |
| XLogP | 0.45 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|