C15H12N4O3 — CID 139787327
5-amino-2-(4-amino-1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 139787327) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 5-amino-2-(4-amino-1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | 5-amino-2-(4-amino-1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 139787327 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-amino-2-(4-amino-1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | NC(=O)c1cc(N)ccc1N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C15H12N4O3/c16-7-4-5-11(9(6-7)13(18)20)19-14(21)8-2-1-3-10(17)12(8)15(19)22/h1-6H,16-17H2,(H2,18,20) |
| InChIKey | JMKJXVISOZPQQY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|