C35H43NO9 — CID 139788205
N-(4,4-diethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3,4a,8a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 139788205) has the molecular formula C35H43NO9 and a molecular weight of 621.73 g/mol. Its IUPAC name is N-(4,4-diethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3,4a,8a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | N-(4,4-diethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3,4a,8a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 139788205 |
| Molecular Formula | C35H43NO9 |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | N-(4,4-diethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3,4a,8a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | CCOC(CCCNC(=O)C1C(=O)C2(O)C3C(OC)=CC(OC)=CC3OC2(c2ccc(OC)cc2)C1c1ccccc1)OCC |
| InChI | InChI=1S/C35H43NO9/c1-6-43-28(44-7-2)14-11-19-36-33(38)29-30(22-12-9-8-10-13-22)35(23-15-17-24(40-3)18-16-23)34(39,32(29)37)31-26(42-5)20-25(41-4)21-27(31)45-35/h8-10,12-13,15-18,20-21,27-31,39H,6-7,11,14,19H2,1-5H3,(H,36,38) |
| InChIKey | WZGRUOROGMVSFS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|