C33H37NO9 — CID 177479658
(2S,3S,3aR,8bR)-N-(4,4-dimethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 177479658) has the molecular formula C33H37NO9 and a molecular weight of 591.66 g/mol. Its IUPAC name is (2S,3S,3aR,8bR)-N-(4,4-dimethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | (2S,3S,3aR,8bR)-N-(4,4-dimethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 177479658 |
| Molecular Formula | C33H37NO9 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | (2S,3S,3aR,8bR)-N-(4,4-dimethoxybutyl)-8b-hydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | COc1ccc([C@@]23Oc4cc(OC)cc(OC)c4[C@]2(O)C(=O)[C@@H](C(=O)NCCCC(OC)OC)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C33H37NO9/c1-38-22-15-13-21(14-16-22)33-28(20-10-7-6-8-11-20)27(31(36)34-17-9-12-26(41-4)42-5)30(35)32(33,37)29-24(40-3)18-23(39-2)19-25(29)43-33/h6-8,10-11,13-16,18-19,26-28,37H,9,12,17H2,1-5H3,(H,34,36)/t27-,28+,32-,33-/m0/s1 |
| InChIKey | QJZAESQZDBHKGU-SNJRAOIRSA-N |
| XLogP | 3.69 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|