C13H17Cl3O6 — CID 139788317
(1,6-dihydroxy-1-prop-2-enoyloxyhexyl) 2-(trichloromethyl)prop-2-enoate (PubChem CID 139788317) has the molecular formula C13H17Cl3O6 and a molecular weight of 375.63 g/mol. Its IUPAC name is (1,6-dihydroxy-1-prop-2-enoyloxyhexyl) 2-(trichloromethyl)prop-2-enoate.
| Compound Name | (1,6-dihydroxy-1-prop-2-enoyloxyhexyl) 2-(trichloromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 139788317 |
| Molecular Formula | C13H17Cl3O6 |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | (1,6-dihydroxy-1-prop-2-enoyloxyhexyl) 2-(trichloromethyl)prop-2-enoate |
| SMILES | C=CC(=O)OC(O)(CCCCCO)OC(=O)C(=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H17Cl3O6/c1-3-10(18)21-12(20,7-5-4-6-8-17)22-11(19)9(2)13(14,15)16/h3,17,20H,1-2,4-8H2 |
| InChIKey | YPKWUJUJQHCIIN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|