C24H25NO5 — CID 139789667
2-[(1R)-2-(cyclohexylmethoxy)-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 139789667) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[(1R)-2-(cyclohexylmethoxy)-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(1R)-2-(cyclohexylmethoxy)-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 139789667 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[(1R)-2-(cyclohexylmethoxy)-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N([C@@H](COCC1CCCCC1)c1ccccc1)C2=O |
| InChI | InChI=1S/C24H25NO5/c26-22-19-12-11-18(24(28)29)13-20(19)23(27)25(22)21(17-9-5-2-6-10-17)15-30-14-16-7-3-1-4-8-16/h2,5-6,9-13,16,21H,1,3-4,7-8,14-15H2,(H,28,29)/t21-/m0/s1 |
| InChIKey | JFGIBGKOWSMWFH-NRFANRHFSA-N |
| XLogP | 4.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|