C27H31NO6 — CID 139789603
2-ethoxyethyl 2-[(1S)-2-cyclohexyloxy-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 139789603) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[(1S)-2-cyclohexyloxy-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-ethoxyethyl 2-[(1S)-2-cyclohexyloxy-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 139789603 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-ethoxyethyl 2-[(1S)-2-cyclohexyloxy-1-phenylethyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOCCOC(=O)c1ccc2c(c1)C(=O)N([C@H](COC1CCCCC1)c1ccccc1)C2=O |
| InChI | InChI=1S/C27H31NO6/c1-2-32-15-16-33-27(31)20-13-14-22-23(17-20)26(30)28(25(22)29)24(19-9-5-3-6-10-19)18-34-21-11-7-4-8-12-21/h3,5-6,9-10,13-14,17,21,24H,2,4,7-8,11-12,15-16,18H2,1H3/t24-/m1/s1 |
| InChIKey | DZAYKGALYYPSJY-XMMPIXPASA-N |
| XLogP | 4.57 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|