C21H24ClN3O4S2 — CID 139792117
2-[4-(1,3-dithiol-2-ylidene)-3,5-dioxo-2H-1-benzazepin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide;hydrochloride (PubChem CID 139792117) has the molecular formula C21H24ClN3O4S2 and a molecular weight of 482.03 g/mol. Its IUPAC name is 2-[4-(1,3-dithiol-2-ylidene)-3,5-dioxo-2H-1-benzazepin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-[4-(1,3-dithiol-2-ylidene)-3,5-dioxo-2H-1-benzazepin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 139792117 |
| Molecular Formula | C21H24ClN3O4S2 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-[4-(1,3-dithiol-2-ylidene)-3,5-dioxo-2H-1-benzazepin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CC(=O)C(=C2SC=CS2)C(=O)c2ccccc21)NCCN1CCOCC1 |
| InChI | InChI=1S/C21H23N3O4S2.ClH/c25-17-13-24(14-18(26)22-5-6-23-7-9-28-10-8-23)16-4-2-1-3-15(16)20(27)19(17)21-29-11-12-30-21;/h1-4,11-12H,5-10,13-14H2,(H,22,26);1H |
| InChIKey | IYKOGZCTOBNJBK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|