C23H24ClNO3 — CID 139794938
N-(4-chloro-2,6-diethylphenyl)-4-oxo-2-propylchromene-3-carboxamide (PubChem CID 139794938) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is N-(4-chloro-2,6-diethylphenyl)-4-oxo-2-propylchromene-3-carboxamide.
| Compound Name | N-(4-chloro-2,6-diethylphenyl)-4-oxo-2-propylchromene-3-carboxamide |
|---|---|
| PubChem CID | 139794938 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-(4-chloro-2,6-diethylphenyl)-4-oxo-2-propylchromene-3-carboxamide |
| SMILES | CCCc1oc2ccccc2c(=O)c1C(=O)Nc1c(CC)cc(Cl)cc1CC |
| InChI | InChI=1S/C23H24ClNO3/c1-4-9-19-20(22(26)17-10-7-8-11-18(17)28-19)23(27)25-21-14(5-2)12-16(24)13-15(21)6-3/h7-8,10-13H,4-6,9H2,1-3H3,(H,25,27) |
| InChIKey | BOXZMRWLRKZEQF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |