C23H25NO4 — CID 139794944
N-(2,6-diethylphenyl)-5-hydroxy-4-oxo-2-propylchromene-3-carboxamide (PubChem CID 139794944) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-hydroxy-4-oxo-2-propylchromene-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-5-hydroxy-4-oxo-2-propylchromene-3-carboxamide |
|---|---|
| PubChem CID | 139794944 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-hydroxy-4-oxo-2-propylchromene-3-carboxamide |
| SMILES | CCCc1oc2cccc(O)c2c(=O)c1C(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C23H25NO4/c1-4-9-17-20(22(26)19-16(25)12-8-13-18(19)28-17)23(27)24-21-14(5-2)10-7-11-15(21)6-3/h7-8,10-13,25H,4-6,9H2,1-3H3,(H,24,27) |
| InChIKey | YSTCNJYQZULVGM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |