C24H34N2O2 — CID 23037899
N-(2,6-diethylphenyl)-2,5,6-trimethyl-4-oxo-1-pentylpyridine-3-carboxamide (PubChem CID 23037899) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2,5,6-trimethyl-4-oxo-1-pentylpyridine-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-2,5,6-trimethyl-4-oxo-1-pentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 23037899 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | N-(2,6-diethylphenyl)-2,5,6-trimethyl-4-oxo-1-pentylpyridine-3-carboxamide |
| SMILES | CCCCCn1c(C)c(C)c(=O)c(C(=O)Nc2c(CC)cccc2CC)c1C |
| InChI | InChI=1S/C24H34N2O2/c1-7-10-11-15-26-17(5)16(4)23(27)21(18(26)6)24(28)25-22-19(8-2)13-12-14-20(22)9-3/h12-14H,7-11,15H2,1-6H3,(H,25,28) |
| InChIKey | LJUQKLYLLJUTEW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|