C25H36N2O2 — CID 23040137
6-ethyl-N-(2-ethyl-6-methylphenyl)-1-hexyl-2,5-dimethyl-4-oxopyridine-3-carboxamide (PubChem CID 23040137) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 6-ethyl-N-(2-ethyl-6-methylphenyl)-1-hexyl-2,5-dimethyl-4-oxopyridine-3-carboxamide.
| Compound Name | 6-ethyl-N-(2-ethyl-6-methylphenyl)-1-hexyl-2,5-dimethyl-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 23040137 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 6-ethyl-N-(2-ethyl-6-methylphenyl)-1-hexyl-2,5-dimethyl-4-oxopyridine-3-carboxamide |
| SMILES | CCCCCCn1c(C)c(C(=O)Nc2c(C)cccc2CC)c(=O)c(C)c1CC |
| InChI | InChI=1S/C25H36N2O2/c1-7-10-11-12-16-27-19(6)22(24(28)18(5)21(27)9-3)25(29)26-23-17(4)14-13-15-20(23)8-2/h13-15H,7-12,16H2,1-6H3,(H,26,29) |
| InChIKey | RFKQMUHHRZODMR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|