C22H29ClN2O2 — CID 21289438
5-chloro-N-(2,6-dimethylphenyl)-1-hexyl-2,6-dimethyl-4-oxopyridine-3-carboxamide (PubChem CID 21289438) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 5-chloro-N-(2,6-dimethylphenyl)-1-hexyl-2,6-dimethyl-4-oxopyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(2,6-dimethylphenyl)-1-hexyl-2,6-dimethyl-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 21289438 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 5-chloro-N-(2,6-dimethylphenyl)-1-hexyl-2,6-dimethyl-4-oxopyridine-3-carboxamide |
| SMILES | CCCCCCn1c(C)c(Cl)c(=O)c(C(=O)Nc2c(C)cccc2C)c1C |
| InChI | InChI=1S/C22H29ClN2O2/c1-6-7-8-9-13-25-16(4)18(21(26)19(23)17(25)5)22(27)24-20-14(2)11-10-12-15(20)3/h10-12H,6-9,13H2,1-5H3,(H,24,27) |
| InChIKey | WTCGUZVAKWAPIB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|