C21H27BrN2O2S — CID 21289454
5-bromo-N-(2-ethyl-6-methylphenyl)-1-(2-ethylsulfanylethyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide (PubChem CID 21289454) has the molecular formula C21H27BrN2O2S and a molecular weight of 451.43 g/mol. Its IUPAC name is 5-bromo-N-(2-ethyl-6-methylphenyl)-1-(2-ethylsulfanylethyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(2-ethyl-6-methylphenyl)-1-(2-ethylsulfanylethyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 21289454 |
| Molecular Formula | C21H27BrN2O2S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 5-bromo-N-(2-ethyl-6-methylphenyl)-1-(2-ethylsulfanylethyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide |
| SMILES | CCSCCn1c(C)c(Br)c(=O)c(C(=O)Nc2c(C)cccc2CC)c1C |
| InChI | InChI=1S/C21H27BrN2O2S/c1-6-16-10-8-9-13(3)19(16)23-21(26)17-14(4)24(11-12-27-7-2)15(5)18(22)20(17)25/h8-10H,6-7,11-12H2,1-5H3,(H,23,26) |
| InChIKey | NBEFYPGJMHXAOJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|