About 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide
2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide (PubChem CID 139795074) has the molecular formula C25H25N3O3S2
and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide |
| PubChem CID | 139795074 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide |
| SMILES | Cc1ccc2c(c1C)N(CCCN(C)S(=O)(=O)c1ccccc1C#N)c1ccccc1S2=O |
| InChI | InChI=1S/C25H25N3O3S2/c1-18-13-14-23-25(19(18)2)28(21-10-5-6-11-22(21)32(23)29)16-8-15-27(3)33(30,31)24-12-7-4-9-20(24)17-26/h4-7,9-14H,8,15-16H2,1-3H3 |
| InChIKey | RCQLRYTVOHIISV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide?
The IUPAC name of 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide (CID 139795074) is 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide.
What is the SMILES notation for 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide?
The canonical SMILES for 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide is Cc1ccc2c(c1C)N(CCCN(C)S(=O)(=O)c1ccccc1C#N)c1ccccc1S2=O.
What is the InChIKey of 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide?
The InChIKey is RCQLRYTVOHIISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O3S2/c1-18-13-14-23-25(19(18)2)28(21-10-5-6-11-22(21)32(23)29)16-8-15-27(3)33(30,31)24-12-7-4-9-20(24)17-26/h4-7,9-14H,8,15-16H2,1-3H3.
What are the key properties of 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide?
2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide has a molecular weight of 479.63 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]-N-methylbenzenesulfonamide is sourced from PubChem (CID 139795074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).