C14H16N4O2 — CID 139795725
(3aS,6R,6aR)-6-azido-4-benzyl-2-methyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one (PubChem CID 139795725) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (3aS,6R,6aR)-6-azido-4-benzyl-2-methyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6R,6aR)-6-azido-4-benzyl-2-methyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 139795725 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3aS,6R,6aR)-6-azido-4-benzyl-2-methyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one |
| SMILES | CC1C[C@H]2[C@@H](O1)[C@@H](N=[N+]=[N-])C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C14H16N4O2/c1-9-7-11-13(20-9)12(16-17-15)14(19)18(11)8-10-5-3-2-4-6-10/h2-6,9,11-13H,7-8H2,1H3/t9?,11-,12+,13+/m0/s1 |
| InChIKey | PLMQDEJRQIMEGO-HGDNVOPISA-N |
| XLogP | 2.25 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|