C20H42O6Si2 — CID 139796691
ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]propanedioate (PubChem CID 139796691) has the molecular formula C20H42O6Si2 and a molecular weight of 434.72 g/mol. Its IUPAC name is ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]propanedioate.
| Compound Name | ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]propanedioate |
|---|---|
| PubChem CID | 139796691 |
| Molecular Formula | C20H42O6Si2 |
| Molecular Weight | 434.72 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]propanedioate |
| SMILES | CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H42O6Si2/c1-14(25-27(8,9)10)16(26-28(11,12)13)15(17(21)23-19(2,3)4)18(22)24-20(5,6)7/h14-16H,1-13H3 |
| InChIKey | FRDJZEBDQUFPBY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|