C24H58O8Si6 — CID 91746744
bis(trimethylsilyl) 2-trimethylsilyloxy-2-[(1R,2R)-1,2,3-tris(trimethylsilyloxy)propyl]propanedioate (PubChem CID 91746744) has the molecular formula C24H58O8Si6 and a molecular weight of 643.24 g/mol. Its IUPAC name is bis(trimethylsilyl) 2-trimethylsilyloxy-2-[(1R,2R)-1,2,3-tris(trimethylsilyloxy)propyl]propanedioate.
| Compound Name | bis(trimethylsilyl) 2-trimethylsilyloxy-2-[(1R,2R)-1,2,3-tris(trimethylsilyloxy)propyl]propanedioate |
|---|---|
| PubChem CID | 91746744 |
| Molecular Formula | C24H58O8Si6 |
| Molecular Weight | 643.24 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | bis(trimethylsilyl) 2-trimethylsilyloxy-2-[(1R,2R)-1,2,3-tris(trimethylsilyloxy)propyl]propanedioate |
| SMILES | C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H58O8Si6/c1-33(2,3)27-19-20(28-34(4,5)6)21(29-35(7,8)9)24(32-38(16,17)18,22(25)30-36(10,11)12)23(26)31-37(13,14)15/h20-21H,19H2,1-18H3/t20-,21-/m1/s1 |
| InChIKey | PEUWEFJXHJKYKW-NHCUHLMSSA-N |
| XLogP | 6.62 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.24 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|