C17H42O5Si4 — CID 523325
trimethylsilyl (2S,3R)-2-methyl-2,3,4-tris(trimethylsilyloxy)butanoate (PubChem CID 523325) has the molecular formula C17H42O5Si4 and a molecular weight of 438.86 g/mol. Its IUPAC name is trimethylsilyl (2S,3R)-2-methyl-2,3,4-tris(trimethylsilyloxy)butanoate.
| Compound Name | trimethylsilyl (2S,3R)-2-methyl-2,3,4-tris(trimethylsilyloxy)butanoate |
|---|---|
| PubChem CID | 523325 |
| Molecular Formula | C17H42O5Si4 |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | trimethylsilyl (2S,3R)-2-methyl-2,3,4-tris(trimethylsilyloxy)butanoate |
| SMILES | C[C@@](O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H42O5Si4/c1-17(22-26(11,12)13,16(18)21-25(8,9)10)15(20-24(5,6)7)14-19-23(2,3)4/h15H,14H2,1-13H3/t15-,17+/m1/s1 |
| InChIKey | UZLWHXGOWNGVDE-WBVHZDCISA-N |
| XLogP | 5.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|