C25H27N3O3 — CID 139800493
(3R,5S)-5-[[4-(4-cyanophenyl)phenoxy]methyl]-N-ethyl-3-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxamide (PubChem CID 139800493) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is (3R,5S)-5-[[4-(4-cyanophenyl)phenoxy]methyl]-N-ethyl-3-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxamide.
| Compound Name | (3R,5S)-5-[[4-(4-cyanophenyl)phenoxy]methyl]-N-ethyl-3-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 139800493 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (3R,5S)-5-[[4-(4-cyanophenyl)phenoxy]methyl]-N-ethyl-3-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxamide |
| SMILES | C=CC[C@]1(C)C[C@@H](COc2ccc(-c3ccc(C#N)cc3)cc2)N(C(=O)NCC)C1=O |
| InChI | InChI=1S/C25H27N3O3/c1-4-14-25(3)15-21(28(23(25)29)24(30)27-5-2)17-31-22-12-10-20(11-13-22)19-8-6-18(16-26)7-9-19/h4,6-13,21H,1,5,14-15,17H2,2-3H3,(H,27,30)/t21-,25+/m0/s1 |
| InChIKey | COYMYOXWVUNSLN-SQJMNOBHSA-N |
| XLogP | 4.52 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|