C15H32O2Si — CID 139804875
2,2,6,6-tetraethyl-1,1-dimethoxysilinane (PubChem CID 139804875) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is 2,2,6,6-tetraethyl-1,1-dimethoxysilinane.
| Compound Name | 2,2,6,6-tetraethyl-1,1-dimethoxysilinane |
|---|---|
| PubChem CID | 139804875 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | 2,2,6,6-tetraethyl-1,1-dimethoxysilinane |
| SMILES | CCC1(CC)CCCC(CC)(CC)[Si]1(OC)OC |
| InChI | InChI=1S/C15H32O2Si/c1-7-14(8-2)12-11-13-15(9-3,10-4)18(14,16-5)17-6/h7-13H2,1-6H3 |
| InChIKey | AJBWOCYHWJSKJB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|