C16H32O2Si — CID 174467925
2-ethyl-2-prop-2-enyl-1,1-dipropoxysilinane (PubChem CID 174467925) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is 2-ethyl-2-prop-2-enyl-1,1-dipropoxysilinane.
| Compound Name | 2-ethyl-2-prop-2-enyl-1,1-dipropoxysilinane |
|---|---|
| PubChem CID | 174467925 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 2-ethyl-2-prop-2-enyl-1,1-dipropoxysilinane |
| SMILES | C=CCC1(CC)CCCC[Si]1(OCCC)OCCC |
| InChI | InChI=1S/C16H32O2Si/c1-5-11-16(8-4)12-9-10-15-19(16,17-13-6-2)18-14-7-3/h5H,1,6-15H2,2-4H3 |
| InChIKey | ZTNMOVMDLIMPGF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|