C18H40N2O3Si — CID 175322546
2-(1,1,2-tripropoxysilinan-2-yl)butane-1,2-diamine (PubChem CID 175322546) has the molecular formula C18H40N2O3Si and a molecular weight of 360.62 g/mol. Its IUPAC name is 2-(1,1,2-tripropoxysilinan-2-yl)butane-1,2-diamine.
| Compound Name | 2-(1,1,2-tripropoxysilinan-2-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 175322546 |
| Molecular Formula | C18H40N2O3Si |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 2-(1,1,2-tripropoxysilinan-2-yl)butane-1,2-diamine |
| SMILES | CCCOC1(C(N)(CC)CN)CCCC[Si]1(OCCC)OCCC |
| InChI | InChI=1S/C18H40N2O3Si/c1-5-12-21-18(17(20,8-4)16-19)11-9-10-15-24(18,22-13-6-2)23-14-7-3/h5-16,19-20H2,1-4H3 |
| InChIKey | VFZJJVXNGPQUOD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|