C14H34O6Si2 — CID 174509145
diethoxy(methyl)silane;1,1,2,2-tetramethoxysilinane (PubChem CID 174509145) has the molecular formula C14H34O6Si2 and a molecular weight of 354.59 g/mol. Its IUPAC name is diethoxy(methyl)silane;1,1,2,2-tetramethoxysilinane.
| Compound Name | diethoxy(methyl)silane;1,1,2,2-tetramethoxysilinane |
|---|---|
| PubChem CID | 174509145 |
| Molecular Formula | C14H34O6Si2 |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | diethoxy(methyl)silane;1,1,2,2-tetramethoxysilinane |
| SMILES | CCO[SiH](C)OCC.COC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C9H20O4Si.C5H14O2Si/c1-10-9(11-2)7-5-6-8-14(9,12-3)13-4;1-4-6-8(3)7-5-2/h5-8H2,1-4H3;8H,4-5H2,1-3H3 |
| InChIKey | YCQALRKCWXJLKA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|